C13H16BrF3N2O2 — CID 107342252
2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]-N-ethylpropanamide (PubChem CID 107342252) has the molecular formula C13H16BrF3N2O2 and a molecular weight of 369.18 g/mol. Its IUPAC name is 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]-N-ethylpropanamide.
| Compound Name | 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 107342252 |
| Molecular Formula | C13H16BrF3N2O2 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)NCc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H16BrF3N2O2/c1-3-18-12(20)8(2)19-7-9-4-5-11(10(14)6-9)21-13(15,16)17/h4-6,8,19H,3,7H2,1-2H3,(H,18,20) |
| InChIKey | QQTUJVQVGRVSGE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |