C13H13Br2F3O2 — CID 107336755
2-bromo-1-[3-bromo-4-(trifluoromethoxy)phenyl]hexan-3-one (PubChem CID 107336755) has the molecular formula C13H13Br2F3O2 and a molecular weight of 418.05 g/mol. Its IUPAC name is 2-bromo-1-[3-bromo-4-(trifluoromethoxy)phenyl]hexan-3-one.
| Compound Name | 2-bromo-1-[3-bromo-4-(trifluoromethoxy)phenyl]hexan-3-one |
|---|---|
| PubChem CID | 107336755 |
| Molecular Formula | C13H13Br2F3O2 |
| Molecular Weight | 418.05 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | 2-bromo-1-[3-bromo-4-(trifluoromethoxy)phenyl]hexan-3-one |
| SMILES | CCCC(=O)C(Br)Cc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H13Br2F3O2/c1-2-3-11(19)9(14)6-8-4-5-12(10(15)7-8)20-13(16,17)18/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | FTCUGKHJBRUSEG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.05 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|