C11H14BrNO5 — CID 90194120
(3S)-3-amino-4-[3-bromo-4-(trihydroxymethoxy)phenyl]butan-2-one (PubChem CID 90194120) has the molecular formula C11H14BrNO5 and a molecular weight of 320.14 g/mol. Its IUPAC name is (3S)-3-amino-4-[3-bromo-4-(trihydroxymethoxy)phenyl]butan-2-one.
| Compound Name | (3S)-3-amino-4-[3-bromo-4-(trihydroxymethoxy)phenyl]butan-2-one |
|---|---|
| PubChem CID | 90194120 |
| Molecular Formula | C11H14BrNO5 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | (3S)-3-amino-4-[3-bromo-4-(trihydroxymethoxy)phenyl]butan-2-one |
| SMILES | CC(=O)[C@@H](N)Cc1ccc(OC(O)(O)O)c(Br)c1 |
| InChI | InChI=1S/C11H14BrNO5/c1-6(14)9(13)5-7-2-3-10(8(12)4-7)18-11(15,16)17/h2-4,9,15-17H,5,13H2,1H3/t9-/m0/s1 |
| InChIKey | RVXIQBZLEJNMAU-VIFPVBQESA-N |
| XLogP | -0.13 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|