C15H19BrF3NO3 — CID 122128411
2-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122128411) has the molecular formula C15H19BrF3NO3 and a molecular weight of 398.22 g/mol. Its IUPAC name is 2-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122128411 |
| Molecular Formula | C15H19BrF3NO3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCc1ccc(OC(F)(F)F)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C15H19BrF3NO3/c1-3-14(4-2,13(21)22)9-20-8-10-5-6-12(11(16)7-10)23-15(17,18)19/h5-7,20H,3-4,8-9H2,1-2H3,(H,21,22) |
| InChIKey | WOILIXJTJFVWPV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |