C17H24ClNO3 — CID 122128997
2-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122128997) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122128997 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | C=CCOc1ccc(CNCC(CC)(CC)C(=O)O)cc1Cl |
| InChI | InChI=1S/C17H24ClNO3/c1-4-9-22-15-8-7-13(10-14(15)18)11-19-12-17(5-2,6-3)16(20)21/h4,7-8,10,19H,1,5-6,9,11-12H2,2-3H3,(H,20,21) |
| InChIKey | BZDVBGMUAPIVJD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|