C14H16ClNO4 — CID 12796233
methyl 2-[[2-(3-chloro-4-prop-2-enoxyphenyl)acetyl]amino]acetate (PubChem CID 12796233) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is methyl 2-[[2-(3-chloro-4-prop-2-enoxyphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(3-chloro-4-prop-2-enoxyphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 12796233 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl 2-[[2-(3-chloro-4-prop-2-enoxyphenyl)acetyl]amino]acetate |
| SMILES | C=CCOc1ccc(CC(=O)NCC(=O)OC)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4/c1-3-6-20-12-5-4-10(7-11(12)15)8-13(17)16-9-14(18)19-2/h3-5,7H,1,6,8-9H2,2H3,(H,16,17) |
| InChIKey | HCWVTZNCEZIIAT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|