C17H25ClO3Si — CID 6429910
[tert-butyl(dimethyl)silyl] 2-(3-chloro-4-prop-2-enoxyphenyl)acetate (PubChem CID 6429910) has the molecular formula C17H25ClO3Si and a molecular weight of 340.92 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-(3-chloro-4-prop-2-enoxyphenyl)acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-(3-chloro-4-prop-2-enoxyphenyl)acetate |
|---|---|
| PubChem CID | 6429910 |
| Molecular Formula | C17H25ClO3Si |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-(3-chloro-4-prop-2-enoxyphenyl)acetate |
| SMILES | C=CCOc1ccc(CC(=O)O[Si](C)(C)C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C17H25ClO3Si/c1-7-10-20-15-9-8-13(11-14(15)18)12-16(19)21-22(5,6)17(2,3)4/h7-9,11H,1,10,12H2,2-6H3 |
| InChIKey | ZDVORYVUQJYAMM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|