C19H19ClO5 — CID 3534941
2-[4-[(3-chloro-4-prop-2-enoxyphenyl)methoxy]-3-methoxyphenyl]acetic acid (PubChem CID 3534941) has the molecular formula C19H19ClO5 and a molecular weight of 362.81 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-prop-2-enoxyphenyl)methoxy]-3-methoxyphenyl]acetic acid.
| Compound Name | 2-[4-[(3-chloro-4-prop-2-enoxyphenyl)methoxy]-3-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 3534941 |
| Molecular Formula | C19H19ClO5 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-[4-[(3-chloro-4-prop-2-enoxyphenyl)methoxy]-3-methoxyphenyl]acetic acid |
| SMILES | C=CCOc1ccc(COc2ccc(CC(=O)O)cc2OC)cc1Cl |
| InChI | InChI=1S/C19H19ClO5/c1-3-8-24-16-6-5-14(9-15(16)20)12-25-17-7-4-13(11-19(21)22)10-18(17)23-2/h3-7,9-10H,1,8,11-12H2,2H3,(H,21,22) |
| InChIKey | GCKMFQAJIUDYRW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|