C12H16ClNO — CID 17157875
N-[(3-chloro-4-ethoxyphenyl)methyl]prop-2-en-1-amine (PubChem CID 17157875) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxyphenyl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(3-chloro-4-ethoxyphenyl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 17157875 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-[(3-chloro-4-ethoxyphenyl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1ccc(OCC)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO/c1-3-7-14-9-10-5-6-12(15-4-2)11(13)8-10/h3,5-6,8,14H,1,4,7,9H2,2H3 |
| InChIKey | LAFNNXGPIXVZTE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|