C14H20BrNO2 — CID 122129319
2-[[(3-bromophenyl)methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 122129319) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-[[(3-bromophenyl)methylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[(3-bromophenyl)methylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 122129319 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[(3-bromophenyl)methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNCc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C14H20BrNO2/c1-3-14(4-2,13(17)18)10-16-9-11-6-5-7-12(15)8-11/h5-8,16H,3-4,9-10H2,1-2H3,(H,17,18) |
| InChIKey | WNGCPITTXSNPPU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |