C14H18F3NO2 — CID 122129000
2-ethyl-2-[[(3,4,5-trifluorophenyl)methylamino]methyl]butanoic acid (PubChem CID 122129000) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-ethyl-2-[[(3,4,5-trifluorophenyl)methylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[(3,4,5-trifluorophenyl)methylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 122129000 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-ethyl-2-[[(3,4,5-trifluorophenyl)methylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNCc1cc(F)c(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C14H18F3NO2/c1-3-14(4-2,13(19)20)8-18-7-9-5-10(15)12(17)11(16)6-9/h5-6,18H,3-4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | JOKSMNZJKCAOCW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|