C16H22BrNO3 — CID 115429457
2-[[3-(3-bromophenyl)propanoylamino]methyl]-2-ethylbutanoic acid (PubChem CID 115429457) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-[[3-(3-bromophenyl)propanoylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[3-(3-bromophenyl)propanoylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 115429457 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[[3-(3-bromophenyl)propanoylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)CCc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C16H22BrNO3/c1-3-16(4-2,15(20)21)11-18-14(19)9-8-12-6-5-7-13(17)10-12/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | DMKQLZRPSGOUNV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |