C14H20Br2N2O — CID 115693123
N-tert-butyl-2-[(3,4-dibromophenyl)methylamino]propanamide (PubChem CID 115693123) has the molecular formula C14H20Br2N2O and a molecular weight of 392.14 g/mol. Its IUPAC name is N-tert-butyl-2-[(3,4-dibromophenyl)methylamino]propanamide.
| Compound Name | N-tert-butyl-2-[(3,4-dibromophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 115693123 |
| Molecular Formula | C14H20Br2N2O |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | N-tert-butyl-2-[(3,4-dibromophenyl)methylamino]propanamide |
| SMILES | CC(NCc1ccc(Br)c(Br)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H20Br2N2O/c1-9(13(19)18-14(2,3)4)17-8-10-5-6-11(15)12(16)7-10/h5-7,9,17H,8H2,1-4H3,(H,18,19) |
| InChIKey | PWLQTCNTEBTWCP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |