C17H30N2OSi — CID 103438042
N-tert-butyl-2-[(4-trimethylsilylphenyl)methylamino]propanamide (PubChem CID 103438042) has the molecular formula C17H30N2OSi and a molecular weight of 306.53 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-trimethylsilylphenyl)methylamino]propanamide.
| Compound Name | N-tert-butyl-2-[(4-trimethylsilylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 103438042 |
| Molecular Formula | C17H30N2OSi |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-tert-butyl-2-[(4-trimethylsilylphenyl)methylamino]propanamide |
| SMILES | CC(NCc1ccc([Si](C)(C)C)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H30N2OSi/c1-13(16(20)19-17(2,3)4)18-12-14-8-10-15(11-9-14)21(5,6)7/h8-11,13,18H,12H2,1-7H3,(H,19,20) |
| InChIKey | ZSEOJDGGPFORMF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|