C13H15BrF3NOS — CID 107342553
N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107342553) has the molecular formula C13H15BrF3NOS and a molecular weight of 370.23 g/mol. Its IUPAC name is N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107342553 |
| Molecular Formula | C13H15BrF3NOS |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | FC(F)(F)Oc1ccc(CNCC2CCSC2)cc1Br |
| InChI | InChI=1S/C13H15BrF3NOS/c14-11-5-9(1-2-12(11)19-13(15,16)17)6-18-7-10-3-4-20-8-10/h1-2,5,10,18H,3-4,6-8H2 |
| InChIKey | GLCANWFANJTPNF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |