C12H15BrClNS — CID 107302810
N-[(4-bromo-3-chlorophenyl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107302810) has the molecular formula C12H15BrClNS and a molecular weight of 320.68 g/mol. Its IUPAC name is N-[(4-bromo-3-chlorophenyl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(4-bromo-3-chlorophenyl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107302810 |
| Molecular Formula | C12H15BrClNS |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | N-[(4-bromo-3-chlorophenyl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | Clc1cc(CNCC2CCSC2)ccc1Br |
| InChI | InChI=1S/C12H15BrClNS/c13-11-2-1-9(5-12(11)14)6-15-7-10-3-4-16-8-10/h1-2,5,10,15H,3-4,6-8H2 |
| InChIKey | NRXDUHONDXKPMY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |