C13H17NO2S — CID 107131270
N-(1,3-benzodioxol-5-ylmethyl)-1-(thiolan-3-yl)methanamine (PubChem CID 107131270) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-(thiolan-3-yl)methanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107131270 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(thiolan-3-yl)methanamine |
| SMILES | c1cc2c(cc1CNCC1CCSC1)OCO2 |
| InChI | InChI=1S/C13H17NO2S/c1-2-12-13(16-9-15-12)5-10(1)6-14-7-11-3-4-17-8-11/h1-2,5,11,14H,3-4,6-9H2 |
| InChIKey | JOMQJVJHNORFQS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |