C14H19NO3S — CID 115625940
6-[(thian-4-ylmethylamino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 115625940) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 6-[(thian-4-ylmethylamino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(thian-4-ylmethylamino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 115625940 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-[(thian-4-ylmethylamino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CNCC1CCSCC1)OCO2 |
| InChI | InChI=1S/C14H19NO3S/c16-12-6-14-13(17-9-18-14)5-11(12)8-15-7-10-1-3-19-4-2-10/h5-6,10,15-16H,1-4,7-9H2 |
| InChIKey | GWOYOTNOXFYECZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|