C12H17NO2S — CID 107295244
4-[(thiolan-3-ylmethylamino)methyl]benzene-1,3-diol (PubChem CID 107295244) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-[(thiolan-3-ylmethylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(thiolan-3-ylmethylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107295244 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 4-[(thiolan-3-ylmethylamino)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNCC2CCSC2)c(O)c1 |
| InChI | InChI=1S/C12H17NO2S/c14-11-2-1-10(12(15)5-11)7-13-6-9-3-4-16-8-9/h1-2,5,9,13-15H,3-4,6-8H2 |
| InChIKey | FDEGFGCAUSSBHW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|