C12H15F2NS — CID 107132101
N-[(2,5-difluorophenyl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107132101) has the molecular formula C12H15F2NS and a molecular weight of 243.32 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107132101 |
| Molecular Formula | C12H15F2NS |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | Fc1ccc(F)c(CNCC2CCSC2)c1 |
| InChI | InChI=1S/C12H15F2NS/c13-11-1-2-12(14)10(5-11)7-15-6-9-3-4-16-8-9/h1-2,5,9,15H,3-4,6-8H2 |
| InChIKey | YSSIYNLPJWABPR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |