C12H15BrFNS — CID 107131948
N-[(5-bromo-2-fluorophenyl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107131948) has the molecular formula C12H15BrFNS and a molecular weight of 304.23 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107131948 |
| Molecular Formula | C12H15BrFNS |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | Fc1ccc(Br)cc1CNCC1CCSC1 |
| InChI | InChI=1S/C12H15BrFNS/c13-11-1-2-12(14)10(5-11)7-15-6-9-3-4-16-8-9/h1-2,5,9,15H,3-4,6-8H2 |
| InChIKey | GWSAWNONAZPKAC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |