C13H18BrNOS — CID 107166210
N-[(5-bromo-2-methoxyphenyl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107166210) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107166210 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | COc1ccc(Br)cc1CNCC1CCSC1 |
| InChI | InChI=1S/C13H18BrNOS/c1-16-13-3-2-12(14)6-11(13)8-15-7-10-4-5-17-9-10/h2-3,6,10,15H,4-5,7-9H2,1H3 |
| InChIKey | NYQDDNMCJHURPQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |