C13H19NO2S — CID 107131165
3,4-dimethoxy-N-(thiolan-3-ylmethyl)aniline (PubChem CID 107131165) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(thiolan-3-ylmethyl)aniline.
| Compound Name | 3,4-dimethoxy-N-(thiolan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 107131165 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3,4-dimethoxy-N-(thiolan-3-ylmethyl)aniline |
| SMILES | COc1ccc(NCC2CCSC2)cc1OC |
| InChI | InChI=1S/C13H19NO2S/c1-15-12-4-3-11(7-13(12)16-2)14-8-10-5-6-17-9-10/h3-4,7,10,14H,5-6,8-9H2,1-2H3 |
| InChIKey | TZSVPFRXZWUMKB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|