C12H13BrF3NOS — CID 107336077
3-bromo-N-(thiolan-3-ylmethyl)-4-(trifluoromethoxy)aniline (PubChem CID 107336077) has the molecular formula C12H13BrF3NOS and a molecular weight of 356.21 g/mol. Its IUPAC name is 3-bromo-N-(thiolan-3-ylmethyl)-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-(thiolan-3-ylmethyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107336077 |
| Molecular Formula | C12H13BrF3NOS |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-bromo-N-(thiolan-3-ylmethyl)-4-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1ccc(NCC2CCSC2)cc1Br |
| InChI | InChI=1S/C12H13BrF3NOS/c13-10-5-9(17-6-8-3-4-19-7-8)1-2-11(10)18-12(14,15)16/h1-2,5,8,17H,3-4,6-7H2 |
| InChIKey | WQLIQOCKBKCGDG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|