C12H7Br3F3NO2 — CID 107336097
3-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 107336097) has the molecular formula C12H7Br3F3NO2 and a molecular weight of 493.90 g/mol. Its IUPAC name is 3-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107336097 |
| Molecular Formula | C12H7Br3F3NO2 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 490.80 |
| IUPAC Name | 3-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1ccc(NCc2cc(Br)c(Br)o2)cc1Br |
| InChI | InChI=1S/C12H7Br3F3NO2/c13-8-3-6(1-2-10(8)21-12(16,17)18)19-5-7-4-9(14)11(15)20-7/h1-4,19H,5H2 |
| InChIKey | QADQMQDEKJFFOW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|