C11H11BrF3NO — CID 107336219
3-bromo-N-but-3-enyl-4-(trifluoromethoxy)aniline (PubChem CID 107336219) has the molecular formula C11H11BrF3NO and a molecular weight of 310.11 g/mol. Its IUPAC name is 3-bromo-N-but-3-enyl-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-but-3-enyl-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107336219 |
| Molecular Formula | C11H11BrF3NO |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 3-bromo-N-but-3-enyl-4-(trifluoromethoxy)aniline |
| SMILES | C=CCCNc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrF3NO/c1-2-3-6-16-8-4-5-10(9(12)7-8)17-11(13,14)15/h2,4-5,7,16H,1,3,6H2 |
| InChIKey | SYTHJRJQWNAJAO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|