C13H17BrF3NO3 — CID 107336309
3-bromo-N-(2,2-diethoxyethyl)-4-(trifluoromethoxy)aniline (PubChem CID 107336309) has the molecular formula C13H17BrF3NO3 and a molecular weight of 372.18 g/mol. Its IUPAC name is 3-bromo-N-(2,2-diethoxyethyl)-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-(2,2-diethoxyethyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107336309 |
| Molecular Formula | C13H17BrF3NO3 |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 3-bromo-N-(2,2-diethoxyethyl)-4-(trifluoromethoxy)aniline |
| SMILES | CCOC(CNc1ccc(OC(F)(F)F)c(Br)c1)OCC |
| InChI | InChI=1S/C13H17BrF3NO3/c1-3-19-12(20-4-2)8-18-9-5-6-11(10(14)7-9)21-13(15,16)17/h5-7,12,18H,3-4,8H2,1-2H3 |
| InChIKey | ZBTBBLDXMPVBJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|