C13H18F3NO3 — CID 70246305
N-(2,2-diethoxyethyl)-3-(trifluoromethoxy)aniline (PubChem CID 70246305) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-3-(trifluoromethoxy)aniline.
| Compound Name | N-(2,2-diethoxyethyl)-3-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 70246305 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(2,2-diethoxyethyl)-3-(trifluoromethoxy)aniline |
| SMILES | CCOC(CNc1cccc(OC(F)(F)F)c1)OCC |
| InChI | InChI=1S/C13H18F3NO3/c1-3-18-12(19-4-2)9-17-10-6-5-7-11(8-10)20-13(14,15)16/h5-8,12,17H,3-4,9H2,1-2H3 |
| InChIKey | CEVYVEWLPHWDSB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|