C13H18F3NO3 — CID 103409365
N-[3-(2-methoxyethoxy)propyl]-3-(trifluoromethoxy)aniline (PubChem CID 103409365) has the molecular formula C13H18F3NO3 and a molecular weight of 293.28 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-3-(trifluoromethoxy)aniline.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-3-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 103409365 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-3-(trifluoromethoxy)aniline |
| SMILES | COCCOCCCNc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO3/c1-18-8-9-19-7-3-6-17-11-4-2-5-12(10-11)20-13(14,15)16/h2,4-5,10,17H,3,6-9H2,1H3 |
| InChIKey | RUGXYUQRRABOAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|