About ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine
ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine (PubChem CID 156823958) has the molecular formula C19H40N2O3
and a molecular weight of 344.54 g/mol. Its IUPAC name is ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine.
Molecular Properties
| Compound Name | ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine |
| PubChem CID | 156823958 |
| Molecular Formula | C19H40N2O3 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.30 |
| IUPAC Name | ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine |
| SMILES | CC.CC.CCCN.COCCOCCNc1cccc(OC)c1 |
| InChI | InChI=1S/C12H19NO3.C3H9N.2C2H6/c1-14-8-9-16-7-6-13-11-4-3-5-12(10-11)15-2;1-2-3-4;2*1-2/h3-5,10,13H,6-9H2,1-2H3;2-4H2,1H3;2*1-2H3 |
| InChIKey | GKUHMFIBNLOWDW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine?
The IUPAC name of ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine (CID 156823958) is ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine.
What is the SMILES notation for ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine?
The canonical SMILES for ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine is CC.CC.CCCN.COCCOCCNc1cccc(OC)c1.
What is the InChIKey of ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine?
The InChIKey is GKUHMFIBNLOWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3.C3H9N.2C2H6/c1-14-8-9-16-7-6-13-11-4-3-5-12(10-11)15-2;1-2-3-4;2*1-2/h3-5,10,13H,6-9H2,1-2H3;2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine?
ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine has a molecular weight of 344.54 g/mol, XLogP of 4.18, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxy-N-[2-(2-methoxyethoxy)ethyl]aniline;propan-1-amine is sourced from PubChem (CID 156823958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).