C11H15F2NO3 — CID 55233867
3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)aniline (PubChem CID 55233867) has the molecular formula C11H15F2NO3 and a molecular weight of 247.24 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)aniline.
| Compound Name | 3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)aniline |
|---|---|
| PubChem CID | 55233867 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)aniline |
| SMILES | COC(CNc1cccc(OC(F)F)c1)OC |
| InChI | InChI=1S/C11H15F2NO3/c1-15-10(16-2)7-14-8-4-3-5-9(6-8)17-11(12)13/h3-6,10-11,14H,7H2,1-2H3 |
| InChIKey | IBFQFFBACQGIFJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|