C13H21NO4 — CID 63698128
N-(2,2-dimethoxyethyl)-3-(2-methoxyethoxy)aniline (PubChem CID 63698128) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-(2-methoxyethoxy)aniline.
| Compound Name | N-(2,2-dimethoxyethyl)-3-(2-methoxyethoxy)aniline |
|---|---|
| PubChem CID | 63698128 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-(2-methoxyethoxy)aniline |
| SMILES | COCCOc1cccc(NCC(OC)OC)c1 |
| InChI | InChI=1S/C13H21NO4/c1-15-7-8-18-12-6-4-5-11(9-12)14-10-13(16-2)17-3/h4-6,9,13-14H,7-8,10H2,1-3H3 |
| InChIKey | XDDCUUFDEAPVNO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|