C20H27NO3 — CID 54803104
N-[2-(2,6-dimethylphenoxy)propyl]-3-(2-methoxyethoxy)aniline (PubChem CID 54803104) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)propyl]-3-(2-methoxyethoxy)aniline.
| Compound Name | N-[2-(2,6-dimethylphenoxy)propyl]-3-(2-methoxyethoxy)aniline |
|---|---|
| PubChem CID | 54803104 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)propyl]-3-(2-methoxyethoxy)aniline |
| SMILES | COCCOc1cccc(NCC(C)Oc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C20H27NO3/c1-15-7-5-8-16(2)20(15)24-17(3)14-21-18-9-6-10-19(13-18)23-12-11-22-4/h5-10,13,17,21H,11-12,14H2,1-4H3 |
| InChIKey | BZFXXVCPBUOYFG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|