C20H27NO4 — CID 54802183
3-(2-ethoxyethoxy)-N-[2-(4-methoxyphenoxy)propyl]aniline (PubChem CID 54802183) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)-N-[2-(4-methoxyphenoxy)propyl]aniline.
| Compound Name | 3-(2-ethoxyethoxy)-N-[2-(4-methoxyphenoxy)propyl]aniline |
|---|---|
| PubChem CID | 54802183 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-(2-ethoxyethoxy)-N-[2-(4-methoxyphenoxy)propyl]aniline |
| SMILES | CCOCCOc1cccc(NCC(C)Oc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C20H27NO4/c1-4-23-12-13-24-20-7-5-6-17(14-20)21-15-16(2)25-19-10-8-18(22-3)9-11-19/h5-11,14,16,21H,4,12-13,15H2,1-3H3 |
| InChIKey | HFXGGOPDSIXAEF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|