C9H10BrF3N2O3S — CID 107336163
2-[3-bromo-4-(trifluoromethoxy)anilino]ethanesulfonamide (PubChem CID 107336163) has the molecular formula C9H10BrF3N2O3S and a molecular weight of 363.16 g/mol. Its IUPAC name is 2-[3-bromo-4-(trifluoromethoxy)anilino]ethanesulfonamide.
| Compound Name | 2-[3-bromo-4-(trifluoromethoxy)anilino]ethanesulfonamide |
|---|---|
| PubChem CID | 107336163 |
| Molecular Formula | C9H10BrF3N2O3S |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 2-[3-bromo-4-(trifluoromethoxy)anilino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H10BrF3N2O3S/c10-7-5-6(15-3-4-19(14,16)17)1-2-8(7)18-9(11,12)13/h1-2,5,15H,3-4H2,(H2,14,16,17) |
| InChIKey | SMCSASKKGYSHGH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|