C10H11BrF3N3O2 — CID 107336597
2-amino-3-[3-bromo-4-(trifluoromethoxy)anilino]propanamide (PubChem CID 107336597) has the molecular formula C10H11BrF3N3O2 and a molecular weight of 342.12 g/mol. Its IUPAC name is 2-amino-3-[3-bromo-4-(trifluoromethoxy)anilino]propanamide.
| Compound Name | 2-amino-3-[3-bromo-4-(trifluoromethoxy)anilino]propanamide |
|---|---|
| PubChem CID | 107336597 |
| Molecular Formula | C10H11BrF3N3O2 |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-amino-3-[3-bromo-4-(trifluoromethoxy)anilino]propanamide |
| SMILES | NC(=O)C(N)CNc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H11BrF3N3O2/c11-6-3-5(17-4-7(15)9(16)18)1-2-8(6)19-10(12,13)14/h1-3,7,17H,4,15H2,(H2,16,18) |
| InChIKey | NKVWSKIFZSGLLQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|