C8H5BrF3NO3 — CID 23139549
[3-bromo-4-(trifluoromethoxy)phenyl]carbamic acid (PubChem CID 23139549) has the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. Its IUPAC name is [3-bromo-4-(trifluoromethoxy)phenyl]carbamic acid.
| Compound Name | [3-bromo-4-(trifluoromethoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 23139549 |
| Molecular Formula | C8H5BrF3NO3 |
| Molecular Weight | 300.03 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | [3-bromo-4-(trifluoromethoxy)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C8H5BrF3NO3/c9-5-3-4(13-7(14)15)1-2-6(5)16-8(10,11)12/h1-3,13H,(H,14,15) |
| InChIKey | QQXGCWRMPKHDRE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.03 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |