C11H10BrF3N2O2 — CID 107336439
N-[3-bromo-4-(trifluoromethoxy)phenyl]azetidine-3-carboxamide (PubChem CID 107336439) has the molecular formula C11H10BrF3N2O2 and a molecular weight of 339.11 g/mol. Its IUPAC name is N-[3-bromo-4-(trifluoromethoxy)phenyl]azetidine-3-carboxamide.
| Compound Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 107336439 |
| Molecular Formula | C11H10BrF3N2O2 |
| Molecular Weight | 339.11 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]azetidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)c(Br)c1)C1CNC1 |
| InChI | InChI=1S/C11H10BrF3N2O2/c12-8-3-7(17-10(18)6-4-16-5-6)1-2-9(8)19-11(13,14)15/h1-3,6,16H,4-5H2,(H,17,18) |
| InChIKey | KGYABQZPRFPNPO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.11 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |