C11H9BrF3NO2 — CID 175097026
N-[3-bromo-4-(trifluoromethoxy)phenyl]-2-methylprop-2-enamide (PubChem CID 175097026) has the molecular formula C11H9BrF3NO2 and a molecular weight of 324.10 g/mol. Its IUPAC name is N-[3-bromo-4-(trifluoromethoxy)phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 175097026 |
| Molecular Formula | C11H9BrF3NO2 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H9BrF3NO2/c1-6(2)10(17)16-7-3-4-9(8(12)5-7)18-11(13,14)15/h3-5H,1H2,2H3,(H,16,17) |
| InChIKey | QKKXJYQXMLKNFY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|