C12H6BrClF3NO3 — CID 107336561
N-[3-bromo-4-(trifluoromethoxy)phenyl]-5-chlorofuran-2-carboxamide (PubChem CID 107336561) has the molecular formula C12H6BrClF3NO3 and a molecular weight of 384.54 g/mol. Its IUPAC name is N-[3-bromo-4-(trifluoromethoxy)phenyl]-5-chlorofuran-2-carboxamide.
| Compound Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]-5-chlorofuran-2-carboxamide |
|---|---|
| PubChem CID | 107336561 |
| Molecular Formula | C12H6BrClF3NO3 |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]-5-chlorofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)c(Br)c1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H6BrClF3NO3/c13-7-5-6(1-2-8(7)21-12(15,16)17)18-11(19)9-3-4-10(14)20-9/h1-5H,(H,18,19) |
| InChIKey | BOAWXAFGKIHMAK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |