C12H10BrF3N2O2S — CID 107336533
N-[3-bromo-4-(trifluoromethoxy)phenyl]-1-carbamothioylcyclopropane-1-carboxamide (PubChem CID 107336533) has the molecular formula C12H10BrF3N2O2S and a molecular weight of 383.19 g/mol. Its IUPAC name is N-[3-bromo-4-(trifluoromethoxy)phenyl]-1-carbamothioylcyclopropane-1-carboxamide.
| Compound Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]-1-carbamothioylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 107336533 |
| Molecular Formula | C12H10BrF3N2O2S |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | N-[3-bromo-4-(trifluoromethoxy)phenyl]-1-carbamothioylcyclopropane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2ccc(OC(F)(F)F)c(Br)c2)CC1 |
| InChI | InChI=1S/C12H10BrF3N2O2S/c13-7-5-6(1-2-8(7)20-12(14,15)16)18-10(19)11(3-4-11)9(17)21/h1-2,5H,3-4H2,(H2,17,21)(H,18,19) |
| InChIKey | IOWVTEVPQIHBPY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|