C13H14BrFN2O2S — CID 65436760
N-(4-bromo-3-fluorophenyl)-4-carbamothioyloxane-4-carboxamide (PubChem CID 65436760) has the molecular formula C13H14BrFN2O2S and a molecular weight of 361.24 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-4-carbamothioyloxane-4-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-4-carbamothioyloxane-4-carboxamide |
|---|---|
| PubChem CID | 65436760 |
| Molecular Formula | C13H14BrFN2O2S |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-4-carbamothioyloxane-4-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2ccc(Br)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C13H14BrFN2O2S/c14-9-2-1-8(7-10(9)15)17-12(18)13(11(16)20)3-5-19-6-4-13/h1-2,7H,3-6H2,(H2,16,20)(H,17,18) |
| InChIKey | KOEAWRUZFBNTHB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|