C13H13F3N2O2S — CID 62811831
4-carbamothioyl-N-(2,3,5-trifluorophenyl)oxane-4-carboxamide (PubChem CID 62811831) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is 4-carbamothioyl-N-(2,3,5-trifluorophenyl)oxane-4-carboxamide.
| Compound Name | 4-carbamothioyl-N-(2,3,5-trifluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 62811831 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-carbamothioyl-N-(2,3,5-trifluorophenyl)oxane-4-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2cc(F)cc(F)c2F)CCOCC1 |
| InChI | InChI=1S/C13H13F3N2O2S/c14-7-5-8(15)10(16)9(6-7)18-12(19)13(11(17)21)1-3-20-4-2-13/h5-6H,1-4H2,(H2,17,21)(H,18,19) |
| InChIKey | ZHXYQXHQKWCGQJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|