C11H9F3N2OS — CID 80590029
1-carbamothioyl-N-(3,4,5-trifluorophenyl)cyclopropane-1-carboxamide (PubChem CID 80590029) has the molecular formula C11H9F3N2OS and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-carbamothioyl-N-(3,4,5-trifluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(3,4,5-trifluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80590029 |
| Molecular Formula | C11H9F3N2OS |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-carbamothioyl-N-(3,4,5-trifluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C11H9F3N2OS/c12-6-3-5(4-7(13)8(6)14)16-10(17)11(1-2-11)9(15)18/h3-4H,1-2H2,(H2,15,18)(H,16,17) |
| InChIKey | HDOLXNCRBUUFRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|