C12H12BrF3N2O3 — CID 107336426
4-amino-N-[3-bromo-4-(trifluoromethoxy)phenyl]oxolane-3-carboxamide (PubChem CID 107336426) has the molecular formula C12H12BrF3N2O3 and a molecular weight of 369.14 g/mol. Its IUPAC name is 4-amino-N-[3-bromo-4-(trifluoromethoxy)phenyl]oxolane-3-carboxamide.
| Compound Name | 4-amino-N-[3-bromo-4-(trifluoromethoxy)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 107336426 |
| Molecular Formula | C12H12BrF3N2O3 |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 4-amino-N-[3-bromo-4-(trifluoromethoxy)phenyl]oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)Nc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H12BrF3N2O3/c13-8-3-6(1-2-10(8)21-12(14,15)16)18-11(19)7-4-20-5-9(7)17/h1-3,7,9H,4-5,17H2,(H,18,19) |
| InChIKey | YIWYMQDNGPUDAA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |