C12H16N4O3 — CID 66238841
4-amino-N-[4-(carbamoylamino)phenyl]oxolane-3-carboxamide (PubChem CID 66238841) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 4-amino-N-[4-(carbamoylamino)phenyl]oxolane-3-carboxamide.
| Compound Name | 4-amino-N-[4-(carbamoylamino)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66238841 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-amino-N-[4-(carbamoylamino)phenyl]oxolane-3-carboxamide |
| SMILES | NC(=O)Nc1ccc(NC(=O)C2COCC2N)cc1 |
| InChI | InChI=1S/C12H16N4O3/c13-10-6-19-5-9(10)11(17)15-7-1-3-8(4-2-7)16-12(14)18/h1-4,9-10H,5-6,13H2,(H,15,17)(H3,14,16,18) |
| InChIKey | OYCPJUSVYMJGRL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |