C13H16N2O5 — CID 66237709
2-[4-[(4-aminooxolane-3-carbonyl)amino]phenoxy]acetic acid (PubChem CID 66237709) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[4-[(4-aminooxolane-3-carbonyl)amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[(4-aminooxolane-3-carbonyl)amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 66237709 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[4-[(4-aminooxolane-3-carbonyl)amino]phenoxy]acetic acid |
| SMILES | NC1COCC1C(=O)Nc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O5/c14-11-6-19-5-10(11)13(18)15-8-1-3-9(4-2-8)20-7-12(16)17/h1-4,10-11H,5-7,14H2,(H,15,18)(H,16,17) |
| InChIKey | UKAOUNZGDXAUQY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |