C12H13ClF2N2O3 — CID 66235659
4-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]oxolane-3-carboxamide (PubChem CID 66235659) has the molecular formula C12H13ClF2N2O3 and a molecular weight of 306.70 g/mol. Its IUPAC name is 4-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]oxolane-3-carboxamide.
| Compound Name | 4-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66235659 |
| Molecular Formula | C12H13ClF2N2O3 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClF2N2O3/c13-8-3-6(1-2-10(8)20-12(14)15)17-11(18)7-4-19-5-9(7)16/h1-3,7,9,12H,4-5,16H2,(H,17,18) |
| InChIKey | IYARZZNPGAEORQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |