C11H9BrF3N3O2 — CID 107914944
3-bromo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 107914944) has the molecular formula C11H9BrF3N3O2 and a molecular weight of 352.11 g/mol. Its IUPAC name is 3-bromo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107914944 |
| Molecular Formula | C11H9BrF3N3O2 |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 3-bromo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | Cc1nnc(CNc2ccc(OC(F)(F)F)c(Br)c2)o1 |
| InChI | InChI=1S/C11H9BrF3N3O2/c1-6-17-18-10(19-6)5-16-7-2-3-9(8(12)4-7)20-11(13,14)15/h2-4,16H,5H2,1H3 |
| InChIKey | SHMBRYHRJNKBCG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|