C12H11BrF3N3O — CID 107335896
3-bromo-N-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 107335896) has the molecular formula C12H11BrF3N3O and a molecular weight of 350.14 g/mol. Its IUPAC name is 3-bromo-N-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107335896 |
| Molecular Formula | C12H11BrF3N3O |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 3-bromo-N-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | Cc1[nH]cnc1CNc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H11BrF3N3O/c1-7-10(19-6-18-7)5-17-8-2-3-11(9(13)4-8)20-12(14,15)16/h2-4,6,17H,5H2,1H3,(H,18,19) |
| InChIKey | XHYWVDBDJQFOIU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|